EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H31N3O6S2 |
| Net Charge | 0 |
| Average Mass | 497.639 |
| Monoisotopic Mass | 497.16543 |
| SMILES | [H][C@]12[C@@H](C)C(SC3CN(C4=NCCS4)C3)=C(C(=O)OCOC(=O)C(C)(C)C)N1C(=O)[C@]2([H])[C@@H](C)O |
| InChI | InChI=1S/C22H31N3O6S2/c1-11-15-14(12(2)26)18(27)25(15)16(19(28)30-10-31-20(29)22(3,4)5)17(11)33-13-8-24(9-13)21-23-6-7-32-21/h11-15,26H,6-10H2,1-5H3/t11-,12-,14-,15-/m1/s1 |
| InChIKey | SNUDIPVBUUXCDG-QHSBEEBCSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | renoprotective agent Any compound that is able to prevent damage to the kidneys. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tebipenem pivoxil (CHEBI:135799) has role antibacterial agent (CHEBI:33282) |
| tebipenem pivoxil (CHEBI:135799) has role antiinfective agent (CHEBI:35441) |
| tebipenem pivoxil (CHEBI:135799) has role renoprotective agent (CHEBI:231911) |
| tebipenem pivoxil (CHEBI:135799) is a carbapenems (CHEBI:46633) |
| tebipenem pivoxil (CHEBI:135799) is a organic molecular entity (CHEBI:50860) |
| tebipenem pivoxil (CHEBI:135799) is a pivaloyloxymethyl ester (CHEBI:136685) |
| INN | Source |
|---|---|
| tebipenem pivoxilo | WHO MedNet |
| Synonyms | Source |
|---|---|
| L-084 | ChEMBL |
| LJC 11,084 | ChEMBL |
| LJC 11084 | ChEMBL |
| LJC-11084 | ChEMBL |
| ME-1211 | ChEMBL |
| ME1211 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2574 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:161715-24-8 | DrugCentral |
| Citations |
|---|