EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H36O8 |
| Net Charge | 0 |
| Average Mass | 488.577 |
| Monoisotopic Mass | 488.24102 |
| SMILES | [H][C@@]12CC[C@](OC(=O)OCC)(C(=O)COC(=O)CC)[C@@]1(C)C[C@H](O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)C=C[C@@]21C |
| InChI | InChI=1S/C27H36O8/c1-5-22(31)34-15-21(30)27(35-24(32)33-6-2)12-10-19-18-8-7-16-13-17(28)9-11-25(16,3)23(18)20(29)14-26(19,27)4/h9,11,13,18-20,23,29H,5-8,10,12,14-15H2,1-4H3/t18-,19-,20-,23+,25-,26-,27-/m0/s1 |
| InChIKey | FNPXMHRZILFCKX-KAJVQRHHSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| Applications: | dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. antipsoriatic A drug used to treat psoriasis. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prednicarbate (CHEBI:135791) has role antifungal agent (CHEBI:35718) |
| prednicarbate (CHEBI:135791) has role antifungal drug (CHEBI:86327) |
| prednicarbate (CHEBI:135791) has role antipsoriatic (CHEBI:50748) |
| prednicarbate (CHEBI:135791) has role dermatologic drug (CHEBI:50177) |
| prednicarbate (CHEBI:135791) is a corticosteroid hormone (CHEBI:36699) |
| INN | Source |
|---|---|
| prednicarbato | WHO MedNet |
| Synonyms | Source |
|---|---|
| HOE 777 | ChEMBL |
| HOE-777 | ChEMBL |
| LAS-189961 | ChEMBL |
| LAS189961 | ChEMBL |
| NSC-760042 | ChEMBL |
| Prednicarbate | ChEMBL |
| Brand Names | Source |
|---|---|
| Dermatop | ChEMBL |
| Dermatop e emollient | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2243 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:73771-04-7 | DrugCentral |
| Citations |
|---|