EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H31ClF2O5 |
| Net Charge | 0 |
| Average Mass | 484.967 |
| Monoisotopic Mass | 484.18281 |
| SMILES | [H][C@@]12C[C@H](C)[C@](OC(=O)CC)(C(=O)CCl)[C@@]1(C)C[C@H](O)[C@@]1(F)[C@@]2([H])C[C@H](F)C2=CC(=O)C=C[C@@]21C |
| InChI | InChI=1S/C25H31ClF2O5/c1-5-21(32)33-25(20(31)12-26)13(2)8-15-16-10-18(27)17-9-14(29)6-7-22(17,3)24(16,28)19(30)11-23(15,25)4/h6-7,9,13,15-16,18-19,30H,5,8,10-12H2,1-4H3/t13-,15-,16-,18-,19-,22-,23-,24-,25-/m0/s1 |
| InChIKey | BDSYKGHYMJNPAB-LICBFIPMSA-N |
| Roles Classification |
|---|
| Biological Role: | hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| Applications: | antipsoriatic A drug used to treat psoriasis. dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ulobetasol propionate (CHEBI:135782) has role antipsoriatic (CHEBI:50748) |
| ulobetasol propionate (CHEBI:135782) has role dermatologic drug (CHEBI:50177) |
| ulobetasol propionate (CHEBI:135782) is a corticosteroid hormone (CHEBI:36699) |
| Synonyms | Source |
|---|---|
| 21-chloro diflorasone | ChEMBL |
| BMY-30056 | ChEMBL |
| CGP-14,458 | ChEMBL |
| CGP-14458 | ChEMBL |
| Halobetasol | ChEMBL |
| halobetasol propionate | DrugCentral |
| Brand Names | Source |
|---|---|
| Bryhali | ChEMBL |
| Halobetasol propionate component of duobrii | ChEMBL |
| Halobetasol propionate component of idp-118 | ChEMBL |
| Lexette | ChEMBL |
| Ultravate | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1349 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:66852-54-8 | DrugCentral |
| Citations |
|---|