EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H17N9O5S2 |
| Net Charge | 0 |
| Average Mass | 479.504 |
| Monoisotopic Mass | 479.07941 |
| SMILES | [H][C@]12SCC(Cn3nnc(C)n3)=C(C(=O)O)N1C(=O)[C@H]2NC(=O)/C(=N\OC)c1csc(N)n1 |
| InChI | InChI=1S/C16H17N9O5S2/c1-6-20-23-24(21-6)3-7-4-31-14-10(13(27)25(14)11(7)15(28)29)19-12(26)9(22-30-2)8-5-32-16(17)18-8/h5,10,14H,3-4H2,1-2H3,(H2,17,18)(H,19,26)(H,28,29)/b22-9-/t10-,14-/m1/s1 |
| InChIKey | XSPUSVIQHBDITA-RKYNPMAHSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefteram (CHEBI:135776) is a cephalosporin (CHEBI:23066) |
| IUPAC Name |
|---|
| 3-[(5-methyl-2H-tetrazol-2-yl)methyl]-7β-{[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetyl]amino}-3,4-didehydrocepham-4-carboxyic acid |
| INN | Source |
|---|---|
| cefteram | ChemIDplus |
| Synonyms | Source |
|---|---|
| (6R,7R)-7-{[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetyl]amino}-3-[(5-methyl-2H-tetrazol-2-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid | IUPAC |
| cefterame | DrugCentral |
| ceftetrame | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6030279 | Reaxys |
| CAS:82547-58-8 | ChemIDplus |
| CAS:82547-58-8 | DrugCentral |
| Citations |
|---|