EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24Cl2N10 |
| Net Charge | 0 |
| Average Mass | 475.388 |
| Monoisotopic Mass | 474.15625 |
| SMILES | N=C(NC(=N)N1CCN(C(=N)NC(=N)Nc2ccc(Cl)cc2)CC1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H24Cl2N10/c21-13-1-5-15(6-2-13)27-17(23)29-19(25)31-9-11-32(12-10-31)20(26)30-18(24)28-16-7-3-14(22)4-8-16/h1-8H,9-12H2,(H4,23,25,27,29)(H4,24,26,28,30) |
| InChIKey | YNCLPFSAZFGQCD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| picloxydine (CHEBI:135768) has role ophthalmology drug (CHEBI:66981) |
| picloxydine (CHEBI:135768) is a organochlorine compound (CHEBI:36683) |
| INN | Source |
|---|---|
| picloxidina | WHO MedNet |
| Synonyms | Source |
|---|---|
| Picloxydine | ChEMBL |
| picloxydine dihydrochloride | DrugCentral |
| picloxydine HCl | DrugCentral |
| picloxydine hydrochloride | DrugCentral |
| vitabact | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 3467 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:5636-92-0 | DrugCentral |
| Citations |
|---|