EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18Br2N4O2 |
| Net Charge | 0 |
| Average Mass | 470.165 |
| Monoisotopic Mass | 467.97965 |
| SMILES | N=C(N)c1ccc(OCCCOc2ccc(C(=N)N)cc2Br)c(Br)c1 |
| InChI | InChI=1S/C17H18Br2N4O2/c18-12-8-10(16(20)21)2-4-14(12)24-6-1-7-25-15-5-3-11(17(22)23)9-13(15)19/h2-5,8-9H,1,6-7H2,(H3,20,21)(H3,22,23) |
| InChIKey | GMJFVGRUYJHMCO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dibrompropamidine (CHEBI:135760) has role ophthalmology drug (CHEBI:66981) |
| dibrompropamidine (CHEBI:135760) is a aromatic ether (CHEBI:35618) |
| INN | Source |
|---|---|
| dibrompropamidina | WHO MedNet |
| Synonyms | Source |
|---|---|
| dibromopropamidine | DrugCentral |
| dibromopropamidine isethionate | DrugCentral |
| dibromopropamidine isetionate | DrugCentral |
| Dibrompropamidine | ChEMBL |
| dibrompropamidine diisetionate | DrugCentral |
| dibrompropamidine HCl | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 3137 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:496-00-4 | DrugCentral |
| Citations |
|---|