EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H30Cl2N2O5 |
| Net Charge | 0 |
| Average Mass | 461.386 |
| Monoisotopic Mass | 460.15318 |
| SMILES | CCCCCN(CCCOC)C(=O)[C@@H](CCC(=O)O)NC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H30Cl2N2O5/c1-3-4-5-11-25(12-6-13-30-2)21(29)18(9-10-19(26)27)24-20(28)15-7-8-16(22)17(23)14-15/h7-8,14,18H,3-6,9-13H2,1-2H3,(H,24,28)(H,26,27)/t18-/m1/s1 |
| InChIKey | QNQZBKQEIFTHFZ-GOSISDBHSA-N |
| Roles Classification |
|---|
| Application: | antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dexloxiglumide (CHEBI:135747) has role antispasmodic drug (CHEBI:53784) |
| dexloxiglumide (CHEBI:135747) is a glutamic acid derivative (CHEBI:24315) |
| INNs | Source |
|---|---|
| dexloxiglumida | WHO MedNet |
| dexloxiglumide | WHO MedNet |
| Synonyms | Source |
|---|---|
| CR-2017 | ChEMBL |
| D-Loxiglumide | DrugCentral |
| Loxiglumide, (r)- | ChEMBL |
| Loxiglumide (r)-form | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 834 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:119817-90-2 | DrugCentral |
| Citations |
|---|