EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O3 |
| Net Charge | 0 |
| Average Mass | 456.711 |
| Monoisotopic Mass | 456.36035 |
| SMILES | [H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@@H](OC(=O)CCCCCCCCCC)CC[C@@]21[H] |
| InChI | InChI=1S/C30H48O3/c1-4-5-6-7-8-9-10-11-12-28(32)33-27-16-15-25-24-14-13-22-21-23(31)17-19-29(22,2)26(24)18-20-30(25,27)3/h21,24-27H,4-20H2,1-3H3/t24-,25-,26-,27-,29-,30-/m0/s1 |
| InChIKey | UDSFVOAUHKGBEK-CNQKSJKFSA-N |
| Roles Classification |
|---|
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| testosterone undecanoate (CHEBI:135741) has role antineoplastic agent (CHEBI:35610) |
| testosterone undecanoate (CHEBI:135741) has role cardiovascular drug (CHEBI:35554) |
| testosterone undecanoate (CHEBI:135741) has role geroprotector (CHEBI:176497) |
| testosterone undecanoate (CHEBI:135741) is a steroid ester (CHEBI:47880) |
| Synonyms | Source |
|---|---|
| Kyzatrex | ChEMBL |
| MK-3033 | ChEMBL |
| ORG 538 | ChEMBL |
| ORG-538 | ChEMBL |
| Testosterone 17.beta.-undecylate | ChEMBL |
| Testosterone undecanoate | ChEMBL |
| Brand Names | Source |
|---|---|
| Andriol | ChEMBL |
| Aveed | ChEMBL |
| Jatenzo | ChEMBL |
| Nebido | ChEMBL |
| Restandol | ChEMBL |
| Restandol testocap | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2608 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:5949-44-0 | DrugCentral |