EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H42N3O3 |
| Net Charge | +1 |
| Average Mass | 456.651 |
| Monoisotopic Mass | 456.32207 |
| SMILES | [H][C@@]12N(C)c3ccccc3[C@]13C[C@@]1([H])[C@H]([C@H]4C[C@]2([H])[N@+]1(CC(O)CN(CC)CC)[C@H](O)[C@H]4CC)[C@H]3O |
| InChI | InChI=1S/C27H42N3O3/c1-5-17-18-12-21-24-27(19-10-8-9-11-20(19)28(24)4)13-22(23(18)25(27)32)30(21,26(17)33)15-16(31)14-29(6-2)7-3/h8-11,16-18,21-26,31-33H,5-7,12-15H2,1-4H3/q+1/t16?,17-,18-,21-,22-,23-,24-,25+,26+,27+,30-/m0/s1 |
| InChIKey | IXLGLCQSNUMEGQ-PYJPINIGSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| detajmium (CHEBI:135740) is a indole alkaloid (CHEBI:38958) |
| Synonyms | Source |
|---|---|
| detajmium bitartrate | DrugCentral |
| detajmium bitartrate hydrate | DrugCentral |
| tachmalcor | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 823 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:47719-70-0 | DrugCentral |