EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H33NO6 |
| Net Charge | 0 |
| Average Mass | 455.551 |
| Monoisotopic Mass | 455.23079 |
| SMILES | CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC)C1c1ccccc1/C=C/C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H33NO6/c1-8-31-24(29)21-16(3)27-17(4)22(25(30)32-9-2)23(21)19-13-11-10-12-18(19)14-15-20(28)33-26(5,6)7/h10-15,23,27H,8-9H2,1-7H3/b15-14+ |
| InChIKey | GKQPCPXONLDCMU-CCEZHUSRSA-N |
| Roles Classification |
|---|
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lacidipine (CHEBI:135737) has role antihypertensive agent (CHEBI:35674) |
| lacidipine (CHEBI:135737) has role cardiovascular drug (CHEBI:35554) |
| lacidipine (CHEBI:135737) is a tert-butyl ester (CHEBI:140402) |
| lacidipine (CHEBI:135737) is a cinnamate ester (CHEBI:36087) |
| INN | Source |
|---|---|
| lacidipino | WHO MedNet |
| Synonyms | Source |
|---|---|
| 3,3'-iminodipropylamine | ChEMBL |
| 4-azaheptamethylenediamine | ChEMBL |
| Dipropylamine, 3,3'-diamino- | ChEMBL |
| GR 43659X | ChEMBL |
| GR-43659X | DrugCentral |
| Lacidipine | ChEMBL |
| Brand Names | Source |
|---|---|
| Caldine | ChEMBL |
| Molap | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1532 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:103890-78-4 | DrugCentral |
| Citations |
|---|