EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H15ClN2O6S2 |
| Net Charge | 0 |
| Average Mass | 454.913 |
| Monoisotopic Mass | 454.00601 |
| SMILES | Cc1cc2c(cc1CC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1Cl)OCO2 |
| InChI | InChI=1S/C18H15ClN2O6S2/c1-9-5-13-14(26-8-25-13)7-11(9)6-12(22)17-15(3-4-28-17)29(23,24)21-18-16(19)10(2)20-27-18/h3-5,7,21H,6,8H2,1-2H3 |
| InChIKey | PHWXUGHIIBDVKD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. nephroprotective agent Any protective agent that is able to prevent damage to the kidney. anti-asthmatic agent Any compound that has anti-asthmatic effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sitaxentan (CHEBI:135736) has role anti-asthmatic agent (CHEBI:65023) |
| sitaxentan (CHEBI:135736) has role antihypertensive agent (CHEBI:35674) |
| sitaxentan (CHEBI:135736) has role nephroprotective agent (CHEBI:76595) |
| sitaxentan (CHEBI:135736) is a benzodioxoles (CHEBI:38298) |
| Synonyms | Source |
|---|---|
| IPI-1040 | ChEMBL |
| Sitaxentan | ChEMBL |
| sitaxentan sodium | DrugCentral |
| sitaxsentan | DrugCentral |
| TBC-11251 | DrugCentral |
| TBC11251 | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 3548 | DrugCentral |
| HMDB0015629 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:210421-74-2 | DrugCentral |
| Citations |
|---|