EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H15ClN2O6S2 |
| Net Charge | 0 |
| Average Mass | 454.913 |
| Monoisotopic Mass | 454.00601 |
| SMILES | Cc1cc2c(cc1CC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1Cl)OCO2 |
| InChI | InChI=1S/C18H15ClN2O6S2/c1-9-5-13-14(26-8-25-13)7-11(9)6-12(22)17-15(3-4-28-17)29(23,24)21-18-16(19)10(2)20-27-18/h3-5,7,21H,6,8H2,1-2H3 |
| InChIKey | PHWXUGHIIBDVKD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. anti-asthmatic agent Any compound that has anti-asthmatic effects. nephroprotective agent Any protective agent that is able to prevent damage to the kidney. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sitaxentan (CHEBI:135736) has role anti-asthmatic agent (CHEBI:65023) |
| sitaxentan (CHEBI:135736) has role antihypertensive agent (CHEBI:35674) |
| sitaxentan (CHEBI:135736) has role nephroprotective agent (CHEBI:76595) |
| sitaxentan (CHEBI:135736) is a benzodioxoles (CHEBI:38298) |
| sitaxentan (CHEBI:135736) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| IPI-1040 | ChEMBL |
| Sitaxentan | ChEMBL |
| sitaxentan sodium | DrugCentral |
| sitaxsentan | DrugCentral |
| TBC-11251 | DrugCentral |
| TBC11251 | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 3548 | DrugCentral |
| HMDB0015629 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:210421-74-2 | DrugCentral |
| Citations |
|---|