EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H34O4S2 |
| Net Charge | 0 |
| Average Mass | 450.666 |
| Monoisotopic Mass | 450.18985 |
| SMILES | [H][C@]12CC[C@@]3(C)[C@@]([H])(CC[C@]3(C)O)[C@]1([H])[C@H](SC(C)=O)CC1=CC(=O)C[C@H](SC(C)=O)[C@@]12C |
| InChI | InChI=1S/C24H34O4S2/c1-13(25)29-19-11-15-10-16(27)12-20(30-14(2)26)24(15,5)18-6-8-22(3)17(21(18)19)7-9-23(22,4)28/h10,17-21,28H,6-9,11-12H2,1-5H3/t17-,18-,19+,20-,21-,22-,23-,24-/m0/s1 |
| InChIKey | YUOZKOLALXNELS-SQVYRKCQSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tiomesterone (CHEBI:135733) has role androgen (CHEBI:50113) |
| tiomesterone (CHEBI:135733) is a 3-hydroxy steroid (CHEBI:36834) |
| Synonyms | Source |
|---|---|
| emdabolin | DrugCentral |
| thiomesterone | DrugCentral |
| thiomestrone | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 3844 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:2205-73-4 | DrugCentral |