EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H30O6 |
| Net Charge | 0 |
| Average Mass | 450.531 |
| Monoisotopic Mass | 450.20424 |
| SMILES | CC(C)=CCOc1ccc(/C=C/C(=O)c2ccc(OCC=C(C)C)cc2OCC(=O)O)cc1 |
| InChI | InChI=1S/C27H30O6/c1-19(2)13-15-31-22-8-5-21(6-9-22)7-12-25(28)24-11-10-23(32-16-14-20(3)4)17-26(24)33-18-27(29)30/h5-14,17H,15-16,18H2,1-4H3,(H,29,30)/b12-7+ |
| InChIKey | GFWRVVCDTLRWPK-KPKJPENVSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sophora subprostrata (IPNI:518946-1) | root (BTO:0001188) | PubMed (21530127) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Applications: | anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. gastrointestinal drug A drug used for its effects on the gastrointestinal system, e.g. controlling gastric acidity, regulating gastrointestinal motility and water flow, and improving digestion. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sofalcone (CHEBI:135732) has role anti-ulcer drug (CHEBI:49201) |
| sofalcone (CHEBI:135732) has role antibacterial agent (CHEBI:33282) |
| sofalcone (CHEBI:135732) has role gastrointestinal drug (CHEBI:55324) |
| sofalcone (CHEBI:135732) has role plant metabolite (CHEBI:76924) |
| sofalcone (CHEBI:135732) is a aromatic ether (CHEBI:35618) |
| sofalcone (CHEBI:135732) is a chalcones (CHEBI:23086) |
| sofalcone (CHEBI:135732) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| {5-[(3-methylbut-2-en-1-yl)oxy]-2-[(2E)-3-{4-[(3-methylbut-2-en-1-yl)oxy]phenyl}prop-2-enoyl]phenoxy}acetic acid |
| INNs | Source |
|---|---|
| sofalconum | WHO MedNet |
| sofalcone | WHO MedNet |
| sofalcona | WHO MedNet |
| sofalcone | WHO MedNet |
| Synonyms | Source |
|---|---|
| SU-88 | ChemIDplus |
| 2-[5-[(3-methyl-2-buten-1-yl)oxy]-2-[3-[4-[(3-methyl-2-buten-1-yl)oxy]phenyl]-1-oxo-2-propen-1-yl]phenoxy]-acetic acid | ChEBI |
| Brand Names | Source |
|---|---|
| Solon | KEGG DRUG |
| Lavin | ChEBI |
| Tofalcone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2191482 | Reaxys |
| CAS:64506-49-6 | ChemIDplus |
| CAS:153175-87-2 | ChemIDplus |
| Citations |
|---|