EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H27N3O3S2 |
| Net Charge | 0 |
| Average Mass | 445.610 |
| Monoisotopic Mass | 445.14938 |
| SMILES | CS(=O)(=O)c1ccc2c(c1)N(CCCN1CCC(C(N)=O)CC1)c1ccccc1S2 |
| InChI | InChI=1S/C22H27N3O3S2/c1-30(27,28)17-7-8-21-19(15-17)25(18-5-2-3-6-20(18)29-21)12-4-11-24-13-9-16(10-14-24)22(23)26/h2-3,5-8,15-16H,4,9-14H2,1H3,(H2,23,26) |
| InChIKey | BQDBKDMTIJBJLA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| metopimazine (CHEBI:135726) has role antiemetic (CHEBI:50919) |
| metopimazine (CHEBI:135726) is a phenothiazines (CHEBI:38093) |
| INN | Source |
|---|---|
| metopimazina | WHO MedNet |
| Synonyms | Source |
|---|---|
| EXP 999 | ChEMBL |
| EXP-999 | ChEMBL |
| Metopimazine | ChEMBL |
| metopimazine HCl | DrugCentral |
| metopimazine hydrochloride | DrugCentral |
| vogalene | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 1784 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:14008-44-7 | DrugCentral |
| Citations |
|---|