EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H31F3O4 |
| Net Charge | 0 |
| Average Mass | 440.502 |
| Monoisotopic Mass | 440.21744 |
| SMILES | [H][C@@]12C[C@H](C(F)(F)F)C3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1(OC(C)=O)C(C)=O |
| InChI | InChI=1S/C24H31F3O4/c1-13(28)23(31-14(2)29)10-7-18-16-12-20(24(25,26)27)19-11-15(30)5-8-21(19,3)17(16)6-9-22(18,23)4/h11,16-18,20H,5-10,12H2,1-4H3/t16-,17+,18+,20+,21-,22+,23+/m1/s1 |
| InChIKey | MXZYUFNILISKBC-WXLIAARGSA-N |
| Roles Classification |
|---|
| Biological Role: | hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flumedroxone acetate (CHEBI:135717) is a corticosteroid hormone (CHEBI:36699) |
| Synonyms | Source |
|---|---|
| demigran | DrugCentral |
| demigrana | DrugCentral |
| flumedrossone | DrugCentral |
| leomigran | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 3749 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:987-18-8 | DrugCentral |