EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H12N8O4S3 |
| Net Charge | 0 |
| Average Mass | 440.492 |
| Monoisotopic Mass | 440.01436 |
| SMILES | [H][C@]12SCC(CSc3nncs3)=C(C(=O)O)N1C(=O)[C@H]2NC(=O)Cn1cnnn1 |
| InChI | InChI=1S/C13H12N8O4S3/c22-7(1-20-4-14-18-19-20)16-8-10(23)21-9(12(24)25)6(2-26-11(8)21)3-27-13-17-15-5-28-13/h4-5,8,11H,1-3H2,(H,16,22)(H,24,25)/t8-,11-/m1/s1 |
| InChIKey | DZMVCVMFETWNIU-LDYMZIIASA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ceftezole (CHEBI:135716) is a cephalosporin (CHEBI:23066) |
| ceftezole (CHEBI:135716) is a thiadiazoles (CHEBI:38099) |
| IUPAC Name |
|---|
| 7-[2-(1H-tetrazol-1-yl)acetamido]-3-[(1,3,4-thiadiazol-2-ylsulfanyl)methyl]-3,4-didehydrocepham-4-carboxylic acid |
| INNs | Source |
|---|---|
| ceftezol | ChemIDplus |
| ceftezole | ChemIDplus |
| ceftézole | WHO MedNet |
| ceftezolum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (6R,7R)-8-oxo-7-[2-(1H-tetrazol-1-yl)acetamido]-3-[(1,3,4-thiadiazol-2-ylsulfanyl)methyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid | IUPAC |
| ceftezol | DrugCentral |
| demethyl cefazolin | DrugCentral |
| demethylcefazolin | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| Ceftezole | Wikipedia |
| CN101544659 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4046849 | Reaxys |
| CAS:26973-24-0 | ChemIDplus |
| Citations |
|---|