EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H32ClNO2 |
| Net Charge | 0 |
| Average Mass | 438.011 |
| Monoisotopic Mass | 437.21216 |
| SMILES | CCN(CC)CCOc1ccc(C(O)(Cc2ccc(Cl)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C27H32ClNO2/c1-4-29(5-2)18-19-31-26-16-12-24(13-17-26)27(30,23-10-6-21(3)7-11-23)20-22-8-14-25(28)15-9-22/h6-17,30H,4-5,18-20H2,1-3H3 |
| InChIKey | SYHDSBBKRLVLFF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triparanol (CHEBI:135714) has role anticoronaviral agent (CHEBI:149553) |
| triparanol (CHEBI:135714) is a stilbenoid (CHEBI:26776) |
| Synonyms | Source |
|---|---|
| triparin | DrugCentral |
| metasclene | DrugCentral |
| trianel | DrugCentral |
| clotrox | DrugCentral |
| metasqualene | DrugCentral |
| tropalin | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 2761 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:78-41-1 | DrugCentral |