EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H15N5O9S2 |
| Net Charge | 0 |
| Average Mass | 437.412 |
| Monoisotopic Mass | 437.03112 |
| SMILES | CC1(C)[C@H](NC(=O)/C(=N\OCC(=O)O)c2csc(N)n2)C(=O)N1OS(=O)(=O)O |
| InChI | InChI=1S/C12H15N5O9S2/c1-12(2)8(10(21)17(12)26-28(22,23)24)15-9(20)7(16-25-3-6(18)19)5-4-27-11(13)14-5/h4,8H,3H2,1-2H3,(H2,13,14)(H,15,20)(H,18,19)(H,22,23,24)/b16-7-/t8-/m1/s1 |
| InChIKey | VAMSVIZLXJOLHZ-QWFSEIHXSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tigemonam (CHEBI:135713) is a monobactam (CHEBI:50695) |
| Manual Xrefs | Databases |
|---|---|
| 3842 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:102507-71-1 | DrugCentral |