EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H29Cl3O3 |
| Net Charge | 0 |
| Average Mass | 435.819 |
| Monoisotopic Mass | 434.11823 |
| SMILES | [H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@@H](OC(O)C(Cl)(Cl)Cl)CC[C@@]21[H] |
| InChI | InChI=1S/C21H29Cl3O3/c1-19-9-7-13(25)11-12(19)3-4-14-15-5-6-17(27-18(26)21(22,23)24)20(15,2)10-8-16(14)19/h11,14-18,26H,3-10H2,1-2H3/t14-,15-,16-,17-,18?,19-,20-/m0/s1 |
| InChIKey | DNADMXUXHNLBKR-SIGPKOBDSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cloxotestosterone (CHEBI:135711) has role androgen (CHEBI:50113) |
| cloxotestosterone (CHEBI:135711) is a 3-hydroxy steroid (CHEBI:36834) |
| Manual Xrefs | Databases |
|---|---|
| 3113 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:53608-96-1 | DrugCentral |