EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H29N5O6 |
| Net Charge | 0 |
| Average Mass | 435.481 |
| Monoisotopic Mass | 435.21178 |
| SMILES | COc1cc2c(N)nc(N3CCN(C(=O)OCC(C)(C)O)CC3)nc2c(OC)c1OC |
| InChI | InChI=1S/C20H29N5O6/c1-20(2,27)11-31-19(26)25-8-6-24(7-9-25)18-22-14-12(17(21)23-18)10-13(28-3)15(29-4)16(14)30-5/h10,27H,6-9,11H2,1-5H3,(H2,21,22,23) |
| InChIKey | YNZXWQJZEDLQEG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trimazosin (CHEBI:135710) has role antihypertensive agent (CHEBI:35674) |
| trimazosin (CHEBI:135710) is a N-arylpiperazine (CHEBI:46848) |
| INNs | Source |
|---|---|
| trimazosina | WHO MedNet |
| trimazosine | WHO MedNet |
| Synonyms | Source |
|---|---|
| rimazosin hydrochloride monohydrate | DrugCentral |
| Trimazosin | ChEMBL |
| trimazosin HCl | DrugCentral |
| trimazosin hydrochloride | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 2747 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:35795-16-5 | DrugCentral |
| Citations |
|---|