EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22N2O7S |
| Net Charge | 0 |
| Average Mass | 434.470 |
| Monoisotopic Mass | 434.11477 |
| SMILES | CC(C)(C)C(=O)Oc1ccc(S(=O)(=O)Nc2ccccc2C(=O)NCC(=O)O)cc1 |
| InChI | InChI=1S/C20H22N2O7S/c1-20(2,3)19(26)29-13-8-10-14(11-9-13)30(27,28)22-16-7-5-4-6-15(16)18(25)21-12-17(23)24/h4-11,22H,12H2,1-3H3,(H,21,25)(H,23,24) |
| InChIKey | BTGNGJJLZOIYID-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sivelestat (CHEBI:135704) has functional parent N-benzoylglycine (CHEBI:18089) |
| sivelestat (CHEBI:135704) is a N-acylglycine (CHEBI:16180) |
| sivelestat (CHEBI:135704) is a pivalate ester (CHEBI:50784) |
| Manual Xrefs | Databases |
|---|---|
| 2452 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:127373-66-4 | DrugCentral |