EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H25BrN2O3 |
| Net Charge | 0 |
| Average Mass | 433.346 |
| Monoisotopic Mass | 432.10485 |
| SMILES | [H][C@@]12c3c4c5ccc(Br)cc5n3[C@@](O)(C(=O)OC)C[C@]1(CC)CCCN2CC4 |
| InChI | InChI=1S/C21H25BrN2O3/c1-3-20-8-4-9-23-10-7-15-14-6-5-13(22)11-16(14)24(17(15)18(20)23)21(26,12-20)19(25)27-2/h5-6,11,18,26H,3-4,7-10,12H2,1-2H3/t18-,20+,21+/m1/s1 |
| InChIKey | WYIJGAVIVKPUGJ-GIVPXCGWSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| brovincamine (CHEBI:135701) is a alkaloid (CHEBI:22315) |
| Synonyms | Source |
|---|---|
| 11-Bromovincamine | DrugCentral |
| 11-Brovincamine | DrugCentral |
| cis-11-Bromovincamine | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 411 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:57475-17-9 | DrugCentral |