EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H31NO6 |
| Net Charge | 0 |
| Average Mass | 429.513 |
| Monoisotopic Mass | 429.21514 |
| SMILES | [H]C(COc1ccccc1CCc1cccc(OC)c1)(CN(C)C)OC(=O)CCC(=O)O |
| InChI | InChI=1S/C24H31NO6/c1-25(2)16-21(31-24(28)14-13-23(26)27)17-30-22-10-5-4-8-19(22)12-11-18-7-6-9-20(15-18)29-3/h4-10,15,21H,11-14,16-17H2,1-3H3,(H,26,27) |
| InChIKey | FFYNAVGJSYHHFO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sarpogrelate (CHEBI:135697) is a hemisuccinate (CHEBI:138979) |
| sarpogrelate (CHEBI:135697) is a stilbenoid (CHEBI:26776) |
| Synonyms | Source |
|---|---|
| MCI-9042 | DrugCentral |
| sarpogrelate HCl | DrugCentral |
| anplag | DrugCentral |
| sarpogrelate hydrochloride | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 2423 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:125926-17-2 | DrugCentral |