EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20Cl2N2O5 |
| Net Charge | 0 |
| Average Mass | 427.284 |
| Monoisotopic Mass | 426.07493 |
| SMILES | CCOCCN(Cc1ccc(Oc2ccc([N+](=O)[O-])cc2)cc1)C(=O)C(Cl)Cl |
| InChI | InChI=1S/C19H20Cl2N2O5/c1-2-27-12-11-22(19(24)18(20)21)13-14-3-7-16(8-4-14)28-17-9-5-15(6-10-17)23(25)26/h3-10,18H,2,11-13H2,1H3 |
| InChIKey | QTRALMGDQMIVFF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antiamoebic agent An antiparasitic agent which is effective against amoeba, a genus of single-celled amoeboids in the family Amoebidae. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| etofamide (CHEBI:135692) has role antiamoebic agent (CHEBI:171664) |
| etofamide (CHEBI:135692) is a aromatic ether (CHEBI:35618) |
| INN | Source |
|---|---|
| etofamida | WHO MedNet |
| Synonyms | Source |
|---|---|
| chlorophenoxamide ethyl ether | DrugCentral |
| ethylchlordiphene | DrugCentral |
| eticlordifene | DrugCentral |
| Etofamide | ChEMBL |
| Kitnos | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1105 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:25287-60-9 | DrugCentral |
| Citations |
|---|