EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H40N2O2 |
| Net Charge | 0 |
| Average Mass | 424.629 |
| Monoisotopic Mass | 424.30898 |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCN1CCN(Cc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C27H40N2O2/c1-22(2)7-5-8-23(3)9-6-10-24(4)13-14-28-15-17-29(18-16-28)20-25-11-12-26-27(19-25)31-21-30-26/h7,9,11-13,19H,5-6,8,10,14-18,20-21H2,1-4H3 |
| InChIKey | DVJCPEWCHQLAEH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pifarnine (CHEBI:135687) has role anti-ulcer drug (CHEBI:49201) |
| pifarnine (CHEBI:135687) is a N-alkylpiperazine (CHEBI:46845) |
| pifarnine (CHEBI:135687) is a benzodioxoles (CHEBI:38298) |
| pifarnine (CHEBI:135687) is a olefinic compound (CHEBI:78840) |
| IUPAC Name |
|---|
| 1-(1,3-benzodioxol-5-ylmethyl)-4-(3,7,11-trimethyldodeca-2,6,10-trien-1-yl)piperazine |
| INNs | Source |
|---|---|
| pifarnine | WHO MedNet |
| pifarninum | WHO MedNet |
| pifarnina | WHO MedNet |
| pifarnine | WHO MedNet |
| Synonyms | Source |
|---|---|
| U-27 | DrugCentral |
| U27 | ChemIDplus |
| 1-(1,3-benzodioxol-5-ylmethyl)-4-(3,7,11-trimethyl-2,6,10-dodecatrienyl)piperazine | ChemIDplus |
| pifazine | ChemIDplus |
| Brand Name | Source |
|---|---|
| Pifazin | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:56208-01-6 | ChemIDplus |
| Citations |
|---|