EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H32N2O4 |
| Net Charge | 0 |
| Average Mass | 424.541 |
| Monoisotopic Mass | 424.23621 |
| SMILES | C[C@H]1CN(C[C@H](Cc2ccccc2)C(=O)NCC(=O)O)CC[C@@]1(C)c1cccc(O)c1 |
| InChI | InChI=1S/C25H32N2O4/c1-18-16-27(12-11-25(18,2)21-9-6-10-22(28)14-21)17-20(24(31)26-15-23(29)30)13-19-7-4-3-5-8-19/h3-10,14,18,20,28H,11-13,15-17H2,1-2H3,(H,26,31)(H,29,30)/t18-,20-,25+/m0/s1 |
| InChIKey | UPNUIXSCZBYVBB-JVFUWBCBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | gastrointestinal drug A drug used for its effects on the gastrointestinal system, e.g. controlling gastric acidity, regulating gastrointestinal motility and water flow, and improving digestion. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. laxative An agent that produces a soft formed stool, and relaxes and loosens the bowels, typically used over a protracted period, to relieve constipation. Compare with cathartic, which is a substance that accelerates defecation. A substances can be both a laxative and a cathartic. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alvimopan (CHEBI:135686) has role antineoplastic agent (CHEBI:35610) |
| alvimopan (CHEBI:135686) has role gastrointestinal drug (CHEBI:55324) |
| alvimopan (CHEBI:135686) has role laxative (CHEBI:50503) |
| alvimopan (CHEBI:135686) is a peptide (CHEBI:16670) |
| Synonyms | Source |
|---|---|
| ADL 8-2698 | ChEMBL |
| ADL-8-2698 | ChEMBL |
| Alvimopan | ChEMBL |
| alvimopan anhydrous | DrugCentral |
| alvimopan dihydrate | DrugCentral |
| Anhydrous alvimopan | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 143 | DrugCentral |
| HMDB0015631 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:156053-89-3 | DrugCentral |
| Citations |
|---|