EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H38O3 |
| Net Charge | 0 |
| Average Mass | 422.609 |
| Monoisotopic Mass | 422.28210 |
| SMILES | [H][C@@]12CCC3=CC(=O)CC[C@]3([H])[C@@]1([H])CC[C@]1(C)[C@@H](OC(=O)C34C=CC(C)(CC3)CC4)CC[C@@]21[H] |
| InChI | InChI=1S/C28H38O3/c1-26-11-14-28(15-12-26,16-13-26)25(30)31-24-8-7-23-22-5-3-18-17-19(29)4-6-20(18)21(22)9-10-27(23,24)2/h11,14,17,20-24H,3-10,12-13,15-16H2,1-2H3/t20-,21+,22+,23-,24-,26?,27-,28?/m0/s1 |
| InChIKey | REACBNMPQDINOF-YBBIQVIJSA-N |
| Roles Classification |
|---|
| Application: | ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nandrolone cyclotate (CHEBI:135684) has role ophthalmology drug (CHEBI:66981) |
| nandrolone cyclotate (CHEBI:135684) is a steroid ester (CHEBI:47880) |
| Synonyms | Source |
|---|---|
| Nandrolone cyclotate | ChEMBL |
| RS-3268R | ChEMBL |
| sanabolicum | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 1880 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:22263-51-0 | DrugCentral |