EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H24N2O5 |
| Net Charge | 0 |
| Average Mass | 420.465 |
| Monoisotopic Mass | 420.16852 |
| SMILES | COc1ccccc1OC(=O)CNC(=O)Cc1ccc(C(=O)c2ccc(C)cc2)n1C |
| InChI | InChI=1S/C24H24N2O5/c1-16-8-10-17(11-9-16)24(29)19-13-12-18(26(19)2)14-22(27)25-15-23(28)31-21-7-5-4-6-20(21)30-3/h4-13H,14-15H2,1-3H3,(H,25,27) |
| InChIKey | CWJNMKKMGIAGDK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amtolmetin guacil (CHEBI:135678) is a N-acyl-amino acid (CHEBI:51569) |
| Synonyms | Source |
|---|---|
| amtolmetineguacil | DrugCentral |
| amtolmetin guacyl | DrugCentral |
| artromed | DrugCentral |
| ST-679 | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 204 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:87344-06-7 | DrugCentral |