EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H28N2O5 |
| Net Charge | 0 |
| Average Mass | 412.486 |
| Monoisotopic Mass | 412.19982 |
| SMILES | [H][C@@]12CN3CCc4c(nc5cc(OC)c(OC)cc45)[C@@]3([H])C[C@]1([H])C(C(=O)OC)=CO[C@H]2C |
| InChI | InChI=1S/C23H28N2O5/c1-12-16-10-25-6-5-13-15-8-20(27-2)21(28-3)9-18(15)24-22(13)19(25)7-14(16)17(11-30-12)23(26)29-4/h8-9,11-12,14,16,19,24H,5-7,10H2,1-4H3/t12-,14-,16-,19+/m0/s1 |
| InChIKey | FGWJRZQNNZVCHR-BCRCDCHUSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| reserpiline (CHEBI:135667) is a yohimban alkaloid (CHEBI:27358) |
| Synonyms | Source |
|---|---|
| elliptamine | DrugCentral |
| reserpilin | DrugCentral |
| (-)-Reserpiline | DrugCentral |
| reserpiline HCl | DrugCentral |
| reserpiline hydrochloride | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 3522 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:131-02-2 | DrugCentral |