EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H21N7O |
| Net Charge | 0 |
| Average Mass | 411.469 |
| Monoisotopic Mass | 411.18076 |
| SMILES | Cc1nc(C)c2c(n1)N(Cc1ccc(-c3ccccc3-c3nnnn3)cc1)C(=O)CC2 |
| InChI | InChI=1S/C23H21N7O/c1-14-18-11-12-21(31)30(23(18)25-15(2)24-14)13-16-7-9-17(10-8-16)19-5-3-4-6-20(19)22-26-28-29-27-22/h3-10H,11-13H2,1-2H3,(H,26,27,28,29) |
| InChIKey | ADXGNEYLLLSOAR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tasosartan (CHEBI:135666) has role cardiovascular drug (CHEBI:35554) |
| tasosartan (CHEBI:135666) is a biphenyls (CHEBI:22888) |
| Synonyms | Source |
|---|---|
| ANA-756 | DrugCentral |
| ANA756 | DrugCentral |
| Tasosartan | ChEMBL |
| verdia | DrugCentral |
| WAY-ANA-756 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 3839 | DrugCentral |
| HMDB0015439 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:145733-36-4 | DrugCentral |
| Citations |
|---|