EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H31N3OS |
| Net Charge | 0 |
| Average Mass | 409.599 |
| Monoisotopic Mass | 409.21878 |
| SMILES | CCCC(=O)c1ccc2c(c1)N(CCCN1CCN(C)CC1)c1ccccc1S2 |
| InChI | InChI=1S/C24H31N3OS/c1-3-7-22(28)19-10-11-24-21(18-19)27(20-8-4-5-9-23(20)29-24)13-6-12-26-16-14-25(2)15-17-26/h4-5,8-11,18H,3,6-7,12-17H2,1-2H3 |
| InChIKey | DVLBYTMYSMAKHP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| butaperazine (CHEBI:135663) has role antipsychotic agent (CHEBI:35476) |
| butaperazine (CHEBI:135663) is a organic molecular entity (CHEBI:50860) |
| butaperazine (CHEBI:135663) is a phenothiazines (CHEBI:38093) |
| INN | Source |
|---|---|
| butaperazina | WHO MedNet |
| Synonyms | Source |
|---|---|
| AHR-3000 | ChEMBL |
| BAYER 1362 | ChEMBL |
| BAYER-1362 | ChEMBL |
| Butaperazine | ChEMBL |
| butyrylperazine | DrugCentral |
| emerex | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 443 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:653-03-2 | DrugCentral |
| Citations |
|---|