EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H23F4NO2 |
| Net Charge | 0 |
| Average Mass | 409.423 |
| Monoisotopic Mass | 409.16649 |
| SMILES | O=C(CCCN1CCC(O)(c2cccc(C(F)(F)F)c2)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H23F4NO2/c23-19-8-6-16(7-9-19)20(28)5-2-12-27-13-10-21(29,11-14-27)17-3-1-4-18(15-17)22(24,25)26/h1,3-4,6-9,15,29H,2,5,10-14H2 |
| InChIKey | GPMXUUPHFNMNDH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trifluperidol (CHEBI:135662) has role antipsychotic agent (CHEBI:35476) |
| trifluperidol (CHEBI:135662) is a aromatic ketone (CHEBI:76224) |
| Synonyms | Source |
|---|---|
| MCN-JR-2498 | ChEMBL |
| NSC-170978 | ChEMBL |
| psicoperidol | DrugCentral |
| R-2498 | ChEMBL |
| trifluoperidol | DrugCentral |
| Trifluperidol | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2741 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:749-13-3 | DrugCentral |
| Citations |
|---|