EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H27NO3S2 |
| Net Charge | 0 |
| Average Mass | 405.585 |
| Monoisotopic Mass | 405.14324 |
| SMILES | CN1C2CCC(C)(C)C1CC(OC(=O)C(O)(c1cccs1)c1cccs1)C2 |
| InChI | InChI=1S/C21H27NO3S2/c1-20(2)9-8-14-12-15(13-16(20)22(14)3)25-19(23)21(24,17-6-4-10-26-17)18-7-5-11-27-18/h4-7,10-11,14-16,24H,8-9,12-13H2,1-3H3 |
| InChIKey | AMHPTVWBZSYFSS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mazaticol (CHEBI:135656) has role antiparkinson drug (CHEBI:48407) |
| mazaticol (CHEBI:135656) is a piperidines (CHEBI:26151) |
| Synonyms | Source |
|---|---|
| KAO-264 | ChEMBL |
| Mazaticol | ChEMBL |
| mazaticol HCl | DrugCentral |
| mazaticol hydrochloride | DrugCentral |
| mazaticol hydrochloride hydrate | DrugCentral |
| mazaticol hydrochloride monohydrate | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 1639 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:42024-98-6 | DrugCentral |