EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H32N2O2S |
| Net Charge | 0 |
| Average Mass | 400.588 |
| Monoisotopic Mass | 400.21845 |
| SMILES | CC(C)CCOc1ccc(NC(=S)Nc2ccc(OCCC(C)C)cc2)cc1 |
| InChI | InChI=1S/C23H32N2O2S/c1-17(2)13-15-26-21-9-5-19(6-10-21)24-23(28)25-20-7-11-22(12-8-20)27-16-14-18(3)4/h5-12,17-18H,13-16H2,1-4H3,(H2,24,25,28) |
| InChIKey | BWBONKHPVHMQHE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| Application: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tiocarlide (CHEBI:135637) has role antitubercular agent (CHEBI:33231) |
| tiocarlide (CHEBI:135637) is a thioureas (CHEBI:51276) |
| INN | Source |
|---|---|
| tiocarlida | WHO MedNet |
| Synonyms | Source |
|---|---|
| datanil | DrugCentral |
| DAT-C | ChEMBL |
| DATC | ChEMBL |
| disocarban | DrugCentral |
| isoxyl | DrugCentral |
| NSC-742400 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2673 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:910-86-1 | DrugCentral |
| Citations |
|---|