EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22N4O5 |
| Net Charge | 0 |
| Average Mass | 398.419 |
| Monoisotopic Mass | 398.15902 |
| SMILES | CN(C)C(=O)COC(=O)Cc1ccc(OC(=O)c2ccc(NC(=N)N)cc2)cc1 |
| InChI | InChI=1S/C20H22N4O5/c1-24(2)17(25)12-28-18(26)11-13-3-9-16(10-4-13)29-19(27)14-5-7-15(8-6-14)23-20(21)22/h3-10H,11-12H2,1-2H3,(H4,21,22,23) |
| InChIKey | XASIMHXSUQUHLV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. serine protease inhibitor Any protease inhibitor that restricts the action of a serine protease. anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| Applications: | antifibrinolytic drug A drug that prevent fibrinolysis or lysis of a blood clot or thrombus. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. anti-inflammatory agent Any compound that has anti-inflammatory effects. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| camostat (CHEBI:135632) has functional parent 4-guanidinobenzoic acid (CHEBI:125204) |
| camostat (CHEBI:135632) has role anti-inflammatory agent (CHEBI:67079) |
| camostat (CHEBI:135632) has role anticoronaviral agent (CHEBI:149553) |
| camostat (CHEBI:135632) has role antifibrinolytic drug (CHEBI:48675) |
| camostat (CHEBI:135632) has role antihypertensive agent (CHEBI:35674) |
| camostat (CHEBI:135632) has role antineoplastic agent (CHEBI:35610) |
| camostat (CHEBI:135632) has role antiviral agent (CHEBI:22587) |
| camostat (CHEBI:135632) has role serine protease inhibitor (CHEBI:64926) |
| camostat (CHEBI:135632) is a benzoate ester (CHEBI:36054) |
| camostat (CHEBI:135632) is a carboxylic ester (CHEBI:33308) |
| camostat (CHEBI:135632) is a diester (CHEBI:51307) |
| camostat (CHEBI:135632) is a guanidines (CHEBI:24436) |
| camostat (CHEBI:135632) is a tertiary carboxamide (CHEBI:140326) |
| camostat (CHEBI:135632) is conjugate base of camostat(1+) (CHEBI:169939) |
| Incoming Relation(s) |
| camostat(1+) (CHEBI:169939) is conjugate acid of camostat (CHEBI:135632) |
| IUPAC Name |
|---|
| 4-{2-[2-(dimethylamino)-2-oxoethoxy]-2-oxoethyl}phenyl 4-carbamimidamidobenzoate |
| INNs | Source |
|---|---|
| camostat | WHO MedNet |
| camostat | WHO MedNet |
| camostat | WHO MedNet |
| camostatum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 4-{2-[(dimethylcarbamoyl)methoxy]-2-oxoethyl}phenyl 4-carbamimidamidobenzoate | IUPAC |
| N,N-dimethylcarbamoylmethyl 4-(4-guanidinobenzoyloxy)phenylacetate | ChEBI |
| Citations |
|---|