EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21ClFN3O3 |
| Net Charge | 0 |
| Average Mass | 393.846 |
| Monoisotopic Mass | 393.12555 |
| SMILES | N[C@@H]1CCCCN(c2c(F)cc3c(=O)c(C(=O)O)cn(C4CC4)c3c2Cl)C1 |
| InChI | InChI=1S/C19H21ClFN3O3/c20-15-16-12(18(25)13(19(26)27)9-24(16)11-4-5-11)7-14(21)17(15)23-6-2-1-3-10(22)8-23/h7,9-11H,1-6,8,22H2,(H,26,27)/t10-/m1/s1 |
| InChIKey | QFFGVLORLPOAEC-SNVBAGLBSA-N |
| Roles Classification |
|---|
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| besifloxacin (CHEBI:135622) has role antibacterial agent (CHEBI:33282) |
| besifloxacin (CHEBI:135622) has role ophthalmology drug (CHEBI:66981) |
| besifloxacin (CHEBI:135622) is a quinolines (CHEBI:26513) |
| INNs | Source |
|---|---|
| besifloxacine | WHO MedNet |
| besifloxacino | WHO MedNet |
| Synonyms | Source |
|---|---|
| Besifloxacin | ChEMBL |
| besifloxacin HCl | DrugCentral |
| besifloxacin hydrochloride | DrugCentral |
| besivance | DrugCentral |
| BOL-303224-A | DrugCentral |
| ISV-403 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 4111 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:141388-76-3 | DrugCentral |
| Citations |
|---|