EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18N8O5 |
| Net Charge | 0 |
| Average Mass | 390.360 |
| Monoisotopic Mass | 390.14002 |
| SMILES | CNC(=O)c1cnn(-c2nc(N)c3ncn([C@@H]4O[C@H](CO)[C@@H](O)[C@H]4O)c3n2)c1 |
| InChI | InChI=1S/C15H18N8O5/c1-17-13(27)6-2-19-23(3-6)15-20-11(16)8-12(21-15)22(5-18-8)14-10(26)9(25)7(4-24)28-14/h2-3,5,7,9-10,14,24-26H,4H2,1H3,(H,17,27)(H2,16,20,21)/t7-,9-,10-,14-/m1/s1 |
| InChIKey | LZPZPHGJDAGEJZ-AKAIJSEGSA-N |
| Roles Classification |
|---|
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| regadenoson (CHEBI:135613) has role anti-anaemic agent (CHEBI:75835) |
| regadenoson (CHEBI:135613) has role cardiovascular drug (CHEBI:35554) |
| regadenoson (CHEBI:135613) is a purine nucleoside (CHEBI:26394) |
| Synonyms | Source |
|---|---|
| CVT-3146 | DrugCentral |
| lexiscan | DrugCentral |
| rapiscan | DrugCentral |
| regadenoson anhydrous | ChEMBL |
| Regadenoson anhydrous | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2362 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:313348-27-5 | DrugCentral |
| Citations |
|---|