EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H37N7O3 |
| Net Charge | 0 |
| Average Mass | 387.529 |
| Monoisotopic Mass | 387.29579 |
| SMILES | N=C(N)NCCCCCCC(=O)NC(O)C(=O)NCCCCNCCCN |
| InChI | InChI=1S/C17H37N7O3/c18-9-7-11-21-10-5-6-12-22-15(26)16(27)24-14(25)8-3-1-2-4-13-23-17(19)20/h16,21,27H,1-13,18H2,(H,22,26)(H,24,25)(H4,19,20,23) |
| InChIKey | IDINUJSAMVOPCM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gusperimus (CHEBI:135609) is a N-acyl-amino acid (CHEBI:51569) |
| Synonyms | Source |
|---|---|
| deoxyspergualin | DrugCentral |
| (+/-)-Deoxyspergualin | DrugCentral |
| Gusperimus | ChEMBL |
| gusperimus HCl | DrugCentral |
| gusperimus hydrochloride | DrugCentral |
| gusperimus trihydrochloride | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 1347 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:98629-43-7 | DrugCentral |
| Citations |
|---|