EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H40O4P2 |
| Net Charge | 0 |
| Average Mass | 382.462 |
| Monoisotopic Mass | 382.24018 |
| SMILES | CCOCCP(CCOCC)CCP(CCOCC)CCOCC |
| InChI | InChI=1S/C18H40O4P2/c1-5-19-9-13-23(14-10-20-6-2)17-18-24(15-11-21-7-3)16-12-22-8-4/h5-18H2,1-4H3 |
| InChIKey | QCWJONLQSHEGEJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | catalyst A substance that increases the rate of a reaction without modifying the overall standard Gibbs energy change in the reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetrofosmin (CHEBI:135598) is a phosphine (CHEBI:35883) |
| INNs | Source |
|---|---|
| tetrofosmina | WHO MedNet |
| tetrofosmine | WHO MedNet |
| Synonyms | Source |
|---|---|
| P-53 | ChEMBL |
| P53 | ChEMBL |
| Tetrofosmin | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 3592 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:127502-06-1 | DrugCentral |