EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H19NO3 |
| Net Charge | 0 |
| Average Mass | 381.431 |
| Monoisotopic Mass | 381.13649 |
| SMILES | O=C(O)c1cc(-n2c(-c3ccccc3)cc3c2CCc2ccccc2-3)ccc1O |
| InChI | InChI=1S/C25H19NO3/c27-24-13-11-18(14-21(24)25(28)29)26-22-12-10-16-6-4-5-9-19(16)20(22)15-23(26)17-7-2-1-3-8-17/h1-9,11,13-15,27H,10,12H2,(H,28,29) |
| InChIKey | HAWWPSYXSLJRBO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fendosal (CHEBI:135595) has role non-narcotic analgesic (CHEBI:35481) |
| fendosal (CHEBI:135595) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| fendosal (CHEBI:135595) is a benzoindole (CHEBI:38111) |
| fendosal (CHEBI:135595) is a monohydroxybenzoic acid (CHEBI:25389) |
| fendosal (CHEBI:135595) is a pyrroles (CHEBI:26455) |
| IUPAC Name |
|---|
| 2-hydroxy-5-(2-phenyl-4,5-dihydro-3H-benzo[e]indol-3-yl)benzoic acid |
| INNs | Source |
|---|---|
| fendosal | WHO MedNet |
| fendosal | WHO MedNet |
| fendosal | WHO MedNet |
| fendosalum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 3-(3-carboxy-4-hydroxyphenyl)-2-phenyl-4,5-dihydro-3H-benz(e)indole | ChemIDplus |
| 5-(4,5-dihydro-2-phenyl-3H-benz(e)indol-3-yl)-2-hydroxybenzoic acid | ChemIDplus |
| 5-(4,5-dihydro-2-phenyl-3H-benzo[e]indol-3-yl)salicylic acid | ChEBI |
| HP 129 | DrugCentral |
| Brand Name | Source |
|---|---|
| Alnovin | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1665211 | Reaxys |
| CAS:53597-27-6 | ChemIDplus |
| CAS:53597-27-6 | DrugCentral |
| Citations |
|---|