EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H36O5 |
| Net Charge | 0 |
| Average Mass | 380.525 |
| Monoisotopic Mass | 380.25627 |
| SMILES | CCCC[C@H](C)C[C@H](O)/C=C/[C@H]1[C@H](O)CC(=O)[C@@H]1CCCC/C=C/C(=O)O |
| InChI | InChI=1S/C22H36O5/c1-3-4-9-16(2)14-17(23)12-13-19-18(20(24)15-21(19)25)10-7-5-6-8-11-22(26)27/h8,11-13,16-19,21,23,25H,3-7,9-10,14-15H2,1-2H3,(H,26,27)/b11-8+,13-12+/t16-,17+,18+,19+,21+/m0/s1 |
| InChIKey | OJZYRQPMEIEQFC-UAWLTFRCSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| limaprost (CHEBI:135594) is a long-chain fatty acid (CHEBI:15904) |
| Manual Xrefs | Databases |
|---|---|
| 1581 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:74397-12-9 | DrugCentral |