EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:135590 - ambroxol
| Formula | C13H18Br2N2O |
| Net Charge | 0 |
| Average Mass | 378.108 |
| Monoisotopic Mass | 375.97859 |
| SMILES | Nc1c(Br)cc(Br)cc1CN[C@H]1CC[C@H](O)CC1 |
| InChI | InChI=1S/C13H18Br2N2O/c14-9-5-8(13(16)12(15)6-9)7-17-10-1-3-11(18)4-2-10/h5-6,10-11,17-18H,1-4,7,16H2/t10-,11- |
| InChIKey | JBDGDEWWOUBZPM-XYPYZODXSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | antiparkinson drug A drug used in the treatment of Parkinson's disease. antitussive An agent that suppresses cough. Antitussives have a central or a peripheral action on the cough reflex, or a combination of both. Compare with expectorants, which are considered to increase the volume of secretions in the respiratory tract, so facilitating their removal by ciliary action and coughing, and mucolytics, which decrease the viscosity of mucus, facilitating its removal by ciliary action and expectoration. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ambroxol (CHEBI:135590) has role antiparkinson drug (CHEBI:48407) |
| ambroxol (CHEBI:135590) has role antitussive (CHEBI:51177) |
| ambroxol (CHEBI:135590) is a aromatic amine (CHEBI:33860) |
| Synonyms | Source |
|---|---|
| ambroxils | DrugCentral |
| Ambroxol | ChEMBL |
| ambroxol HCl | DrugCentral |
| ambroxol hydrochloride | DrugCentral |
| lasolvan | DrugCentral |
| Tabcin | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 147 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:18683-91-5 | DrugCentral |
| Citations |
|---|