EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H28ClN5O |
| Net Charge | 0 |
| Average Mass | 377.920 |
| Monoisotopic Mass | 377.19824 |
| SMILES | CCc1nn(CCCN2CCN(c3cccc(Cl)c3)CC2)c(=O)n1CC |
| InChI | InChI=1S/C19H28ClN5O/c1-3-18-21-25(19(26)24(18)4-2)10-6-9-22-11-13-23(14-12-22)17-8-5-7-16(20)15-17/h5,7-8,15H,3-4,6,9-14H2,1-2H3 |
| InChIKey | IZBNNCFOBMGTQX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| etoperidone (CHEBI:135589) has role antidepressant (CHEBI:35469) |
| etoperidone (CHEBI:135589) is a piperazines (CHEBI:26144) |
| INN | Source |
|---|---|
| etoperidona | WHO MedNet |
| Synonyms | Source |
|---|---|
| clopradone | DrugCentral |
| Etoperidone | ChEMBL |
| etoperidone HCl | DrugCentral |
| etoperidone hydrochloride | DrugCentral |
| triazolinone | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 1111 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:52942-31-1 | DrugCentral |