EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20ClNO5 |
| Net Charge | 0 |
| Average Mass | 377.824 |
| Monoisotopic Mass | 377.10300 |
| SMILES | CC(C)(Oc1ccc(Cl)cc1)C(=O)OCCCOC(=O)c1cccnc1 |
| InChI | InChI=1S/C19H20ClNO5/c1-19(2,26-16-8-6-15(20)7-9-16)18(23)25-12-4-11-24-17(22)14-5-3-10-21-13-14/h3,5-10,13H,4,11-12H2,1-2H3 |
| InChIKey | AYJVGKWCGIYEAK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ronifibrate (CHEBI:135588) is a monocarboxylic acid (CHEBI:25384) |
| Synonym | Source |
|---|---|
| cloprane | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 2401 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:42597-57-9 | DrugCentral |