EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H36O3 |
| Net Charge | 0 |
| Average Mass | 372.549 |
| Monoisotopic Mass | 372.26645 |
| SMILES | [H]C12CC(=O)CCC1([H])C(C)(C)Oc1cc(C(C)(C)CCCCCC)cc(O)c12 |
| InChI | InChI=1S/C24H36O3/c1-6-7-8-9-12-23(2,3)16-13-20(26)22-18-15-17(25)10-11-19(18)24(4,5)27-21(22)14-16/h13-14,18-19,26H,6-12,15H2,1-5H3 |
| InChIKey | GECBBEABIDMGGL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-obesity agent Any substance which is used to reduce or control weight. |
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antiparkinson drug A drug used in the treatment of Parkinson's disease. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nabilone (CHEBI:135574) has role anti-obesity agent (CHEBI:74518) |
| nabilone (CHEBI:135574) has role antiemetic (CHEBI:50919) |
| nabilone (CHEBI:135574) has role antineoplastic agent (CHEBI:35610) |
| nabilone (CHEBI:135574) has role antiparkinson drug (CHEBI:48407) |
| nabilone (CHEBI:135574) has role antipsychotic agent (CHEBI:35476) |
| nabilone (CHEBI:135574) is a organic heterotricyclic compound (CHEBI:26979) |
| nabilone (CHEBI:135574) is a organooxygen compound (CHEBI:36963) |
| INN | Source |
|---|---|
| nabilona | WHO MedNet |
| Synonyms | Source |
|---|---|
| cesamet | DrugCentral |
| CPD 109514 | ChEMBL |
| CPD-109514 | ChEMBL |
| LY 109514 | DrugCentral |
| LY-109514 | DrugCentral |
| Nabilone | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1862 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:51022-71-0 | DrugCentral |
| Citations |
|---|