EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H36O3 |
| Net Charge | 0 |
| Average Mass | 372.549 |
| Monoisotopic Mass | 372.26645 |
| SMILES | [H]C12CC(=O)CCC1([H])C(C)(C)Oc1cc(C(C)(C)CCCCCC)cc(O)c12 |
| InChI | InChI=1S/C24H36O3/c1-6-7-8-9-12-23(2,3)16-13-20(26)22-18-15-17(25)10-11-19(18)24(4,5)27-21(22)14-16/h13-14,18-19,26H,6-12,15H2,1-5H3 |
| InChIKey | GECBBEABIDMGGL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-obesity agent Any substance which is used to reduce or control weight. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nabilone (CHEBI:135574) has role anti-obesity agent (CHEBI:74518) |
| nabilone (CHEBI:135574) has role antiemetic (CHEBI:50919) |
| nabilone (CHEBI:135574) has role antineoplastic agent (CHEBI:35610) |
| nabilone (CHEBI:135574) has role antiparkinson drug (CHEBI:48407) |
| nabilone (CHEBI:135574) has role antipsychotic agent (CHEBI:35476) |
| nabilone (CHEBI:135574) is a organic heterotricyclic compound (CHEBI:26979) |
| nabilone (CHEBI:135574) is a organooxygen compound (CHEBI:36963) |
| INN | Source |
|---|---|
| nabilona | WHO MedNet |
| Synonyms | Source |
|---|---|
| cesamet | DrugCentral |
| CPD 109514 | ChEMBL |
| CPD-109514 | ChEMBL |
| LY 109514 | DrugCentral |
| LY-109514 | DrugCentral |
| Nabilone | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1862 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:51022-71-0 | DrugCentral |
| Citations |
|---|