EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28O5 |
| Net Charge | 0 |
| Average Mass | 372.461 |
| Monoisotopic Mass | 372.19367 |
| SMILES | [H][C@@]12C[C@H](C)[C@](O)(C(=O)CO)[C@@]1(C)CC(=O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)C=C[C@@]21C |
| InChI | InChI=1S/C22H28O5/c1-12-8-16-15-5-4-13-9-14(24)6-7-20(13,2)19(15)17(25)10-21(16,3)22(12,27)18(26)11-23/h6-7,9,12,15-16,19,23,27H,4-5,8,10-11H2,1-3H3/t12-,15-,16-,19+,20-,21-,22-/m0/s1 |
| InChIKey | PIDANAQULIKBQS-RNUIGHNZSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| meprednisone (CHEBI:135573) has role antineoplastic agent (CHEBI:35610) |
| meprednisone (CHEBI:135573) is a 21-hydroxy steroid (CHEBI:35344) |
| INN | Source |
|---|---|
| meprednisona | WHO MedNet |
| Synonyms | Source |
|---|---|
| betalone | DrugCentral |
| betanisona | DrugCentral |
| bitanisone | DrugCentral |
| Meprednisone | ChEMBL |
| methylprednisone | DrugCentral |
| NSC-527579 | ChEMBL |
| Brand Name | Source |
|---|---|
| Betapar | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1702 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:1247-42-3 | DrugCentral |
| Citations |
|---|