EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H27ClN2O |
| Net Charge | 0 |
| Average Mass | 370.924 |
| Monoisotopic Mass | 370.18119 |
| SMILES | CC(C)N1CCC(N(C(=O)Cc2ccccc2)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C22H27ClN2O/c1-17(2)24-14-12-21(13-15-24)25(20-10-8-19(23)9-11-20)22(26)16-18-6-4-3-5-7-18/h3-11,17,21H,12-16H2,1-2H3 |
| InChIKey | XHOJAWVAWFHGHL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lorcainide (CHEBI:135568) has role anti-arrhythmia drug (CHEBI:38070) |
| lorcainide (CHEBI:135568) is a acetamides (CHEBI:22160) |
| INN | Source |
|---|---|
| lorcainida | WHO MedNet |
| Synonyms | Source |
|---|---|
| Lorcainide | ChEMBL |
| lorcainide HCl | DrugCentral |
| lorcainide hydrochloride | DrugCentral |
| lorcamide | DrugCentral |
| RO 13-1042 | ChEMBL |
| RO-13-1042 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1607 | DrugCentral |
| HMDB0041918 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:59729-31-6 | DrugCentral |
| Citations |
|---|