EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H34O3 |
| Net Charge | 0 |
| Average Mass | 370.533 |
| Monoisotopic Mass | 370.25079 |
| SMILES | [H][C@@]12C[C@@H](C)[C@](C)(C(=O)CC)[C@@]1(C)C[C@H](O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)C=C[C@@]21C |
| InChI | InChI=1S/C24H34O3/c1-6-20(27)24(5)14(2)11-18-17-8-7-15-12-16(25)9-10-22(15,3)21(17)19(26)13-23(18,24)4/h9-10,12,14,17-19,21,26H,6-8,11,13H2,1-5H3/t14-,17+,18+,19+,21-,22+,23+,24-/m1/s1 |
| InChIKey | QTTRZHGPGKRAFB-OOKHYKNYSA-N |
| Roles Classification |
|---|
| Application: | ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rimexolone (CHEBI:135566) has role ophthalmology drug (CHEBI:66981) |
| rimexolone (CHEBI:135566) is a 20-oxo steroid (CHEBI:36885) |
| INN | Source |
|---|---|
| rimexolona | WHO MedNet |
| Synonyms | Source |
|---|---|
| ORG 6216 | ChEMBL |
| ORG-6216 | ChEMBL |
| rimexel | DrugCentral |
| Rimexolon | ChEMBL |
| Rimexolone | ChEMBL |
| trimexolone | DrugCentral |
| Brand Name | Source |
|---|---|
| Vexol | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2384 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:49697-38-3 | DrugCentral |
| Citations |
|---|