EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H33N2O2 |
| Net Charge | +1 |
| Average Mass | 369.529 |
| Monoisotopic Mass | 369.25365 |
| SMILES | [H][C@@]12N(C)c3ccccc3[C@]13C[C@@]1([H])[C@H]([C@H]4C[C@]2([H])[N@+]1(CCC)[C@H](O)[C@H]4CC)[C@H]3O |
| InChI | InChI=1S/C23H33N2O2/c1-4-10-25-17-11-14(13(5-2)22(25)27)19-18(25)12-23(21(19)26)15-8-6-7-9-16(15)24(3)20(17)23/h6-9,13-14,17-22,26-27H,4-5,10-12H2,1-3H3/q+1/t13-,14-,17-,18-,19-,20-,21+,22+,23+,25-/m0/s1 |
| InChIKey | UAUHEPXILIZYCU-ALHOSYKFSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prajmalium (CHEBI:135560) has role anti-arrhythmia drug (CHEBI:38070) |
| prajmalium (CHEBI:135560) is a indole alkaloid (CHEBI:38958) |
| Synonyms | Source |
|---|---|
| N4-Propylajmalinium | DrugCentral |
| N-Propylajmaline | DrugCentral |
| N-Propylajmalinium | DrugCentral |
| prajmaline | DrugCentral |
| prajmaline bitartrate | DrugCentral |
| Prajmalium cation | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2230 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:35080-11-6 | DrugCentral |