EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20N2O4S2 |
| Net Charge | 0 |
| Average Mass | 368.480 |
| Monoisotopic Mass | 368.08645 |
| SMILES | Cc1ncc(CSSCc2cnc(C)c(O)c2CO)c(CO)c1O |
| InChI | InChI=1S/C16H20N2O4S2/c1-9-15(21)13(5-19)11(3-17-9)7-23-24-8-12-4-18-10(2)16(22)14(12)6-20/h3-4,19-22H,5-8H2,1-2H3 |
| InChIKey | SIXLXDIJGIWWFU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyritinol (CHEBI:135554) has role antidepressant (CHEBI:35469) |
| pyritinol (CHEBI:135554) has role antipsychotic agent (CHEBI:35476) |
| pyritinol (CHEBI:135554) has role anxiolytic drug (CHEBI:35474) |
| pyritinol (CHEBI:135554) is a methylpyridines (CHEBI:25340) |
| Synonyms | Source |
|---|---|
| bonifen | DrugCentral |
| dipyridoxolyl disulfide | DrugCentral |
| encefabol | DrugCentral |
| NSC-759229 | ChEMBL |
| piritinol | DrugCentral |
| pyridoxine disulfide | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 2333 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:1098-97-1 | DrugCentral |
| Citations |
|---|